C16H16F2N4 — CID 136786220
(5R,7R)-7-(difluoromethyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 136786220) has the molecular formula C16H16F2N4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (5R,7R)-7-(difluoromethyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile.
| Compound Name | (5R,7R)-7-(difluoromethyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 136786220 |
| Molecular Formula | C16H16F2N4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (5R,7R)-7-(difluoromethyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | Cc1ccc([C@H]2C[C@H](C(F)F)n3ncc(C#N)c3N2)cc1C |
| InChI | InChI=1S/C16H16F2N4/c1-9-3-4-11(5-10(9)2)13-6-14(15(17)18)22-16(21-13)12(7-19)8-20-22/h3-5,8,13-15,21H,6H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | BVCNAZAIFQRDMG-ZIAGYGMSSA-N |
| XLogP | 3.73 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |