C31H24N6O4S — CID 136720070
(9R)-9-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136720070) has the molecular formula C31H24N6O4S and a molecular weight of 576.64 g/mol. Its IUPAC name is (9R)-9-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136720070 |
| Molecular Formula | C31H24N6O4S |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (9R)-9-(4-nitrophenyl)-2-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc([N+](=O)[O-])cc1)n1nc(SCc3ccc(-c4ncc(-c5ccccc5)o4)cc3)nc1N2 |
| InChI | InChI=1S/C31H24N6O4S/c38-25-8-4-7-24-27(25)28(21-13-15-23(16-14-21)37(39)40)36-30(33-24)34-31(35-36)42-18-19-9-11-22(12-10-19)29-32-17-26(41-29)20-5-2-1-3-6-20/h1-3,5-6,9-17,28H,4,7-8,18H2,(H,33,34,35)/t28-/m1/s1 |
| InChIKey | JVQCQWGHJKUPIF-MUUNZHRXSA-N |
| XLogP | 6.82 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|