C19H19N3O4 — CID 136720459
N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-1-ethyl-5-hydroxy-2-methylindole-3-carboxamide (PubChem CID 136720459) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-1-ethyl-5-hydroxy-2-methylindole-3-carboxamide.
| Compound Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-1-ethyl-5-hydroxy-2-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 136720459 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxyphenyl)methylideneamino]-1-ethyl-5-hydroxy-2-methylindole-3-carboxamide |
| SMILES | CCn1c(C)c(C(=O)N/N=C\c2ccc(O)cc2O)c2cc(O)ccc21 |
| InChI | InChI=1S/C19H19N3O4/c1-3-22-11(2)18(15-8-13(23)6-7-16(15)22)19(26)21-20-10-12-4-5-14(24)9-17(12)25/h4-10,23-25H,3H2,1-2H3,(H,21,26)/b20-10- |
| InChIKey | NFVWUKITWGXZAB-JMIUGGIZSA-N |
| XLogP | 2.85 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|