C26H24N4O2 — CID 136723751
4-(1-ethylbenzimidazol-2-yl)-5-imino-1-(4-phenylmethoxyphenyl)-2H-pyrrol-3-ol (PubChem CID 136723751) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-(1-ethylbenzimidazol-2-yl)-5-imino-1-(4-phenylmethoxyphenyl)-2H-pyrrol-3-ol.
| Compound Name | 4-(1-ethylbenzimidazol-2-yl)-5-imino-1-(4-phenylmethoxyphenyl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136723751 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-(1-ethylbenzimidazol-2-yl)-5-imino-1-(4-phenylmethoxyphenyl)-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3n2CC)=C(O)CN1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N4O2/c1-2-29-22-11-7-6-10-21(22)28-26(29)24-23(31)16-30(25(24)27)19-12-14-20(15-13-19)32-17-18-8-4-3-5-9-18/h3-15,27,31H,2,16-17H2,1H3/b27-25- |
| InChIKey | OMNUWDYGOLQIND-RFBIWTDZSA-N |
| XLogP | 5.40 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|