C25H29N5O — CID 136724135
1-(1-benzylpiperidin-4-yl)-4-(1,5-dimethylbenzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol (PubChem CID 136724135) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-4-(1,5-dimethylbenzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-4-(1,5-dimethylbenzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136724135 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-4-(1,5-dimethylbenzimidazol-2-yl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3cc(C)ccc3n2C)=C(O)CN1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N5O/c1-17-8-9-21-20(14-17)27-25(28(21)2)23-22(31)16-30(24(23)26)19-10-12-29(13-11-19)15-18-6-4-3-5-7-18/h3-9,14,19,26,31H,10-13,15-16H2,1-2H3/b26-24- |
| InChIKey | DTHJQFASAHRIKD-LCUIJRPUSA-N |
| XLogP | 4.11 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|