C11H17N3OS — CID 136726591
2-propan-2-yl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one (PubChem CID 136726591) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-propan-2-yl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-propan-2-yl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136726591 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-propan-2-yl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NC2CCSC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H17N3OS/c1-7(2)11-13-9(5-10(15)14-11)12-8-3-4-16-6-8/h5,7-8H,3-4,6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | RIGMGUODOCRSNP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |