C9H13N3OS — CID 136726598
2-methyl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one (PubChem CID 136726598) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-methyl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136726598 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-methyl-4-(thiolan-3-ylamino)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NC2CCSC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H13N3OS/c1-6-10-8(4-9(13)11-6)12-7-2-3-14-5-7/h4,7H,2-3,5H2,1H3,(H2,10,11,12,13) |
| InChIKey | XWELSNMCYNSGAH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |