C35H20F15Te — CID 136728558
CID 136728558 (PubChem CID 136728558) has the molecular formula C35H20F15Te and a molecular weight of 853.11 g/mol.
| Compound Name | CID 136728558 |
|---|---|
| PubChem CID | 136728558 |
| Molecular Formula | C35H20F15Te |
| Molecular Weight | 853.11 g/mol |
| Exact Mass | 855.04 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc([Te](c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C35H20F15Te/c36-31(37,38)21-1-11-26(12-2-21)51(27-13-3-22(4-14-27)32(39,40)41,28-15-5-23(6-16-28)33(42,43)44,29-17-7-24(8-18-29)34(45,46)47)30-19-9-25(10-20-30)35(48,49)50/h1-20H |
| InChIKey | DZCPBYMICREZQP-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.11 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|