C14H16BrN3OS — CID 136729336
2-[(3-amino-2-bromophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one (PubChem CID 136729336) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is 2-[(3-amino-2-bromophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3-amino-2-bromophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136729336 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 2-[(3-amino-2-bromophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(SCc2cccc(N)c2Br)n1 |
| InChI | InChI=1S/C14H16BrN3OS/c1-2-4-10-7-12(19)18-14(17-10)20-8-9-5-3-6-11(16)13(9)15/h3,5-7H,2,4,8,16H2,1H3,(H,17,18,19) |
| InChIKey | HVAJTOQPSNLRIU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|