C10H12ClIN2O — CID 136729885
2-(chloromethyl)-4-cyclopentyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 136729885) has the molecular formula C10H12ClIN2O and a molecular weight of 338.58 g/mol. Its IUPAC name is 2-(chloromethyl)-4-cyclopentyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(chloromethyl)-4-cyclopentyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136729885 |
| Molecular Formula | C10H12ClIN2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 2-(chloromethyl)-4-cyclopentyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCl)nc(C2CCCC2)c1I |
| InChI | InChI=1S/C10H12ClIN2O/c11-5-7-13-9(6-3-1-2-4-6)8(12)10(15)14-7/h6H,1-5H2,(H,13,14,15) |
| InChIKey | ZSQOFSVBHDNPKT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|