C8H10N6O2 — CID 136730496
2-[(4-ethyl-1,2,4-triazol-3-yl)methylimino]imidazolidine-4,5-dione (PubChem CID 136730496) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 2-[(4-ethyl-1,2,4-triazol-3-yl)methylimino]imidazolidine-4,5-dione.
| Compound Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methylimino]imidazolidine-4,5-dione |
|---|---|
| PubChem CID | 136730496 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-[(4-ethyl-1,2,4-triazol-3-yl)methylimino]imidazolidine-4,5-dione |
| SMILES | CCn1cnnc1CN=C1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C8H10N6O2/c1-2-14-4-10-13-5(14)3-9-8-11-6(15)7(16)12-8/h4H,2-3H2,1H3,(H2,9,11,12,15,16) |
| InChIKey | OAFQYHVRZYJZDO-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|