C8H15N5 — CID 106304244
N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]propanimidamide (PubChem CID 106304244) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]propanimidamide.
| Compound Name | N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 106304244 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]propanimidamide |
| SMILES | CC/C(N)=N\Cc1nncn1CC |
| InChI | InChI=1S/C8H15N5/c1-3-7(9)10-5-8-12-11-6-13(8)4-2/h6H,3-5H2,1-2H3,(H2,9,10) |
| InChIKey | QTPLSAXRQYIQJB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|