C9H15ClN4O2 — CID 136730545
4-[3-(2-aminoethoxy)propylamino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136730545) has the molecular formula C9H15ClN4O2 and a molecular weight of 246.70 g/mol. Its IUPAC name is 4-[3-(2-aminoethoxy)propylamino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[3-(2-aminoethoxy)propylamino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136730545 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-[3-(2-aminoethoxy)propylamino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | NCCOCCCNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C9H15ClN4O2/c10-7-8(13-6-14-9(7)15)12-3-1-4-16-5-2-11/h6H,1-5,11H2,(H2,12,13,14,15) |
| InChIKey | PQSHFAXIBIIOMI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|