C9H14ClN3O3 — CID 136730529
5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-1H-pyrimidin-6-one (PubChem CID 136730529) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136730529 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-chloro-4-[3-(2-hydroxyethoxy)propylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCCOCCO)c1Cl |
| InChI | InChI=1S/C9H14ClN3O3/c10-7-8(12-6-13-9(7)15)11-2-1-4-16-5-3-14/h6,14H,1-5H2,(H2,11,12,13,15) |
| InChIKey | WTWJCVZIZMXGOO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|