C9H14ClN3O2 — CID 136973797
5-chloro-4-(3-ethoxypropylamino)-1H-pyrimidin-6-one (PubChem CID 136973797) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 5-chloro-4-(3-ethoxypropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(3-ethoxypropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136973797 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-chloro-4-(3-ethoxypropylamino)-1H-pyrimidin-6-one |
| SMILES | CCOCCCNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C9H14ClN3O2/c1-2-15-5-3-4-11-8-7(10)9(14)13-6-12-8/h6H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | KDDGFONMXBDKCI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|