C20H20N4O2 — CID 136733569
4-phenyl-2-[(2E)-2-[(4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one (PubChem CID 136733569) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-phenyl-2-[(2E)-2-[(4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one.
| Compound Name | 4-phenyl-2-[(2E)-2-[(4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136733569 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-phenyl-2-[(2E)-2-[(4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)Oc1ccc(/C=N/Nc2nc(-c3ccccc3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-14(2)26-17-10-8-15(9-11-17)13-21-24-20-22-18(12-19(25)23-20)16-6-4-3-5-7-16/h3-14H,1-2H3,(H2,22,23,24,25)/b21-13+ |
| InChIKey | RVTAGEMNQUPHHE-FYJGNVAPSA-N |
| XLogP | 3.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|