C17H13BrN4O — CID 136733007
2-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one (PubChem CID 136733007) has the molecular formula C17H13BrN4O and a molecular weight of 369.22 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136733007 |
| Molecular Formula | C17H13BrN4O |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2)nc(N/N=C/c2cccc(Br)c2)[nH]1 |
| InChI | InChI=1S/C17H13BrN4O/c18-14-8-4-5-12(9-14)11-19-22-17-20-15(10-16(23)21-17)13-6-2-1-3-7-13/h1-11H,(H2,20,21,22,23)/b19-11+ |
| InChIKey | AMQRHTXBVXUOER-YBFXNURJSA-N |
| XLogP | 3.65 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|