C15H11BrN4O2 — CID 136733499
2-[(2E)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one (PubChem CID 136733499) has the molecular formula C15H11BrN4O2 and a molecular weight of 359.18 g/mol. Its IUPAC name is 2-[(2E)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2E)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136733499 |
| Molecular Formula | C15H11BrN4O2 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2-[(2E)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-4-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2)nc(N/N=C/c2ccc(Br)o2)[nH]1 |
| InChI | InChI=1S/C15H11BrN4O2/c16-13-7-6-11(22-13)9-17-20-15-18-12(8-14(21)19-15)10-4-2-1-3-5-10/h1-9H,(H2,18,19,20,21)/b17-9+ |
| InChIKey | BTQUPWRJPRVQCS-RQZCQDPDSA-N |
| XLogP | 3.24 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|