C10H17N5O3 — CID 136734034
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 136734034) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 136734034 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)c1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C10H17N5O3/c1-14(2)3-4-15(5-7(16)17)9-8(11)10(18)13-6-12-9/h6H,3-5,11H2,1-2H3,(H,16,17)(H,12,13,18) |
| InChIKey | PAWLSYWGBQLGET-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |