C9H15N5O — CID 136734042
5-amino-4-[(3-methylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136734042) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-amino-4-[(3-methylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[(3-methylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136734042 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 5-amino-4-[(3-methylpyrrolidin-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CC1(Nc2nc[nH]c(=O)c2N)CCNC1 |
| InChI | InChI=1S/C9H15N5O/c1-9(2-3-11-4-9)14-7-6(10)8(15)13-5-12-7/h5,11H,2-4,10H2,1H3,(H2,12,13,14,15) |
| InChIKey | QEAQVSHVDRAZTR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |