C19H25F3N4O3 — CID 136735198
ethyl (5S,7R)-5-[(3S)-1-(cyclopropanecarbonyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 136735198) has the molecular formula C19H25F3N4O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is ethyl (5S,7R)-5-[(3S)-1-(cyclopropanecarbonyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl (5S,7R)-5-[(3S)-1-(cyclopropanecarbonyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 136735198 |
| Molecular Formula | C19H25F3N4O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethyl (5S,7R)-5-[(3S)-1-(cyclopropanecarbonyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2c1N[C@H]([C@H]1CCCN(C(=O)C3CC3)C1)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C19H25F3N4O3/c1-2-29-18(28)13-9-23-26-15(19(20,21)22)8-14(24-16(13)26)12-4-3-7-25(10-12)17(27)11-5-6-11/h9,11-12,14-15,24H,2-8,10H2,1H3/t12-,14-,15+/m0/s1 |
| InChIKey | ZQTYLQZPXCHBCE-AEGPPILISA-N |
| XLogP | 3.00 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |