C21H29F3N4O3 — CID 136886409
ethyl (5R,7S)-5-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 136886409) has the molecular formula C21H29F3N4O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is ethyl (5R,7S)-5-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl (5R,7S)-5-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 136886409 |
| Molecular Formula | C21H29F3N4O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | ethyl (5R,7S)-5-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2c1N[C@@H]([C@H]1CCCN(CC3=CCCOC3)C1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C21H29F3N4O3/c1-2-31-20(29)16-10-25-28-18(21(22,23)24)9-17(26-19(16)28)15-6-3-7-27(12-15)11-14-5-4-8-30-13-14/h5,10,15,17-18,26H,2-4,6-9,11-13H2,1H3/t15-,17+,18-/m0/s1 |
| InChIKey | JBWYLQVFVFOEEP-JQHSSLGASA-N |
| XLogP | 3.41 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|