C10H9NO2 — CID 136735918
5H-quinoline-1-carboxylic acid (PubChem CID 136735918) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5H-quinoline-1-carboxylic acid.
| Compound Name | 5H-quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 136735918 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5H-quinoline-1-carboxylic acid |
| SMILES | O=C(O)N1C=CC=C2CC=CC=C21 |
| InChI | InChI=1S/C10H9NO2/c12-10(13)11-7-3-5-8-4-1-2-6-9(8)11/h1-3,5-7H,4H2,(H,12,13) |
| InChIKey | IJDDQRQHGMQGFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |