C17H12FIN4 — CID 136736441
(7S)-7-(2-fluorophenyl)-5-(4-iodophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136736441) has the molecular formula C17H12FIN4 and a molecular weight of 418.21 g/mol. Its IUPAC name is (7S)-7-(2-fluorophenyl)-5-(4-iodophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (7S)-7-(2-fluorophenyl)-5-(4-iodophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136736441 |
| Molecular Formula | C17H12FIN4 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | (7S)-7-(2-fluorophenyl)-5-(4-iodophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Fc1ccccc1[C@@H]1C=C(c2ccc(I)cc2)Nc2ncnn21 |
| InChI | InChI=1S/C17H12FIN4/c18-14-4-2-1-3-13(14)16-9-15(11-5-7-12(19)8-6-11)22-17-20-10-21-23(16)17/h1-10,16H,(H,20,21,22)/t16-/m0/s1 |
| InChIKey | QYHPDJKRUQQOSQ-INIZCTEOSA-N |
| XLogP | 4.08 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|