C17H14N4O — CID 136829120
2-[(7R)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]phenol (PubChem CID 136829120) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[(7R)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]phenol.
| Compound Name | 2-[(7R)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]phenol |
|---|---|
| PubChem CID | 136829120 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[(7R)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1C=C(c2ccccc2)Nc2ncnn21 |
| InChI | InChI=1S/C17H14N4O/c22-16-9-5-4-8-13(16)15-10-14(12-6-2-1-3-7-12)20-17-18-11-19-21(15)17/h1-11,15,22H,(H,18,19,20)/t15-/m1/s1 |
| InChIKey | DXDXXICUCDYCTN-OAHLLOKOSA-N |
| XLogP | 3.04 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|