C8H11F2N3O2 — CID 136737797
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-1H-pyrimidin-6-one (PubChem CID 136737797) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136737797 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N(CCO)CC(F)F)nc[nH]1 |
| InChI | InChI=1S/C8H11F2N3O2/c9-6(10)4-13(1-2-14)7-3-8(15)12-5-11-7/h3,5-6,14H,1-2,4H2,(H,11,12,15) |
| InChIKey | IDWSXFJZVIIPSM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |