C7H13N5O2 — CID 136738588
4,5-diamino-2-(3-hydroxypropylamino)-1H-pyrimidin-6-one (PubChem CID 136738588) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4,5-diamino-2-(3-hydroxypropylamino)-1H-pyrimidin-6-one.
| Compound Name | 4,5-diamino-2-(3-hydroxypropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136738588 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4,5-diamino-2-(3-hydroxypropylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(NCCCO)[nH]c(=O)c1N |
| InChI | InChI=1S/C7H13N5O2/c8-4-5(9)11-7(12-6(4)14)10-2-1-3-13/h13H,1-3,8H2,(H4,9,10,11,12,14) |
| InChIKey | WBWQBHCKFDNTEO-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|