C36H49N3O9 — CID 136738684
2-[4-[bis[3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propyl]carbamoyloxymethyl]phenoxy]acetic acid (PubChem CID 136738684) has the molecular formula C36H49N3O9 and a molecular weight of 667.80 g/mol. Its IUPAC name is 2-[4-[bis[3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propyl]carbamoyloxymethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[bis[3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propyl]carbamoyloxymethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 136738684 |
| Molecular Formula | C36H49N3O9 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.35 |
| IUPAC Name | 2-[4-[bis[3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propyl]carbamoyloxymethyl]phenoxy]acetic acid |
| SMILES | C/C(=N\CCCN(CCC/N=C(\C)C1=C(O)CC(C)(C)CC1=O)C(=O)OCc1ccc(OCC(=O)O)cc1)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C36H49N3O9/c1-23(32-27(40)17-35(3,4)18-28(32)41)37-13-7-15-39(34(46)48-21-25-9-11-26(12-10-25)47-22-31(44)45)16-8-14-38-24(2)33-29(42)19-36(5,6)20-30(33)43/h9-12,40,42H,7-8,13-22H2,1-6H3,(H,44,45)/b37-23+,38-24+ |
| InChIKey | LVKNMYLKGXSBJG-DNJOOXRZSA-N |
| XLogP | 6.19 |
| TPSA | 175.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|