C17H21BrN4O4S — CID 136739935
3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxyphenyl]propyl-propylsulfamic acid (PubChem CID 136739935) has the molecular formula C17H21BrN4O4S and a molecular weight of 457.35 g/mol. Its IUPAC name is 3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxyphenyl]propyl-propylsulfamic acid.
| Compound Name | 3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxyphenyl]propyl-propylsulfamic acid |
|---|---|
| PubChem CID | 136739935 |
| Molecular Formula | C17H21BrN4O4S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxyphenyl]propyl-propylsulfamic acid |
| SMILES | CCCN(CCCc1ccc(/N=N/c2ccc(Br)cn2)c(O)c1)S(=O)(=O)O |
| InChI | InChI=1S/C17H21BrN4O4S/c1-2-9-22(27(24,25)26)10-3-4-13-5-7-15(16(23)11-13)20-21-17-8-6-14(18)12-19-17/h5-8,11-12,23H,2-4,9-10H2,1H3,(H,24,25,26)/b21-20+ |
| InChIKey | VXKCCNMAZRJDGW-QZQOTICOSA-N |
| XLogP | 4.41 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|