About 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid
6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136742454) has the molecular formula C22H24N2O4S
and a molecular weight of 412.51 g/mol. Its IUPAC name is 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| PubChem CID | 136742454 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CC(C)c1cc(/N=N/c2ccc3cc(S(=O)(=O)O)ccc3c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C22H24N2O4S/c1-13(2)20-11-18(12-21(14(3)4)22(20)25)24-23-17-7-5-16-10-19(29(26,27)28)8-6-15(16)9-17/h5-14,25H,1-4H3,(H,26,27,28)/b24-23+ |
| InChIKey | BMKITPGVAPLYKL-WCWDXBQESA-N |
| XLogP | 6.45 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid?
The IUPAC name of 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid (CID 136742454) is 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
What is the SMILES notation for 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid?
The canonical SMILES for 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid is CC(C)c1cc(/N=N/c2ccc3cc(S(=O)(=O)O)ccc3c2)cc(C(C)C)c1O.
What is the InChIKey of 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid?
The InChIKey is BMKITPGVAPLYKL-WCWDXBQESA-N. The full InChI is InChI=1S/C22H24N2O4S/c1-13(2)20-11-18(12-21(14(3)4)22(20)25)24-23-17-7-5-16-10-19(29(26,27)28)8-6-15(16)9-17/h5-14,25H,1-4H3,(H,26,27,28)/b24-23+.
What are the key properties of 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid?
6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid has a molecular weight of 412.51 g/mol, XLogP of 6.45, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid is sourced from PubChem (CID 136742454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).