C22H24N2O4S — CID 136742454
6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136742454) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136742454 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 6-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CC(C)c1cc(/N=N/c2ccc3cc(S(=O)(=O)O)ccc3c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C22H24N2O4S/c1-13(2)20-11-18(12-21(14(3)4)22(20)25)24-23-17-7-5-16-10-19(29(26,27)28)8-6-15(16)9-17/h5-14,25H,1-4H3,(H,26,27,28)/b24-23+ |
| InChIKey | BMKITPGVAPLYKL-WCWDXBQESA-N |
| XLogP | 6.45 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|