C8H8N2O3 — CID 136743926
4-oxo-3,5,6,8-tetrahydropyrano[3,4-d]pyrimidine-2-carbaldehyde (PubChem CID 136743926) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-oxo-3,5,6,8-tetrahydropyrano[3,4-d]pyrimidine-2-carbaldehyde.
| Compound Name | 4-oxo-3,5,6,8-tetrahydropyrano[3,4-d]pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 136743926 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-oxo-3,5,6,8-tetrahydropyrano[3,4-d]pyrimidine-2-carbaldehyde |
| SMILES | O=Cc1nc2c(c(=O)[nH]1)CCOC2 |
| InChI | InChI=1S/C8H8N2O3/c11-3-7-9-6-4-13-2-1-5(6)8(12)10-7/h3H,1-2,4H2,(H,9,10,12) |
| InChIKey | LUBYVTUELNUGEK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|