C11H13NO3-2 — CID 136744013
2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate (PubChem CID 136744013) has the molecular formula C11H13NO3-2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate.
| Compound Name | 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate |
|---|---|
| PubChem CID | 136744013 |
| Molecular Formula | C11H13NO3-2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate |
| SMILES | CC(C[O-])(C[O-])/N=C/c1ccccc1O |
| InChI | InChI=1S/C11H13NO3/c1-11(7-13,8-14)12-6-9-4-2-3-5-10(9)15/h2-6,15H,7-8H2,1H3/q-2/b12-6+ |
| InChIKey | ZMEQAFWMRITPDP-WUXMJOGZSA-N |
| XLogP | -0.71 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|