About 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate
2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate (PubChem CID 136744013) has the molecular formula C11H13NO3-2
and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate.
Molecular Properties
| Compound Name | 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate |
| PubChem CID | 136744013 |
| Molecular Formula | C11H13NO3-2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate |
| SMILES | CC(C[O-])(C[O-])/N=C/c1ccccc1O |
| InChI | InChI=1S/C11H13NO3/c1-11(7-13,8-14)12-6-9-4-2-3-5-10(9)15/h2-6,15H,7-8H2,1H3/q-2/b12-6+ |
| InChIKey | ZMEQAFWMRITPDP-WUXMJOGZSA-N |
| XLogP | -0.71 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate?
The IUPAC name of 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate (CID 136744013) is 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate.
What is the SMILES notation for 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate?
The canonical SMILES for 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate is CC(C[O-])(C[O-])/N=C/c1ccccc1O.
What is the InChIKey of 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate?
The InChIKey is ZMEQAFWMRITPDP-WUXMJOGZSA-N. The full InChI is InChI=1S/C11H13NO3/c1-11(7-13,8-14)12-6-9-4-2-3-5-10(9)15/h2-6,15H,7-8H2,1H3/q-2/b12-6+.
What are the key properties of 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate?
2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate has a molecular weight of 207.23 g/mol, XLogP of -0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxyphenyl)methylideneamino]-2-methylpropane-1,3-diolate is sourced from PubChem (CID 136744013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).