C29H30N2O — CID 136744327
2,4-ditert-butyl-6-(1H-phenanthro[9,10-d]imidazol-2-yl)phenol (PubChem CID 136744327) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(1H-phenanthro[9,10-d]imidazol-2-yl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(1H-phenanthro[9,10-d]imidazol-2-yl)phenol |
|---|---|
| PubChem CID | 136744327 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2,4-ditert-butyl-6-(1H-phenanthro[9,10-d]imidazol-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(-c2nc3c4ccccc4c4ccccc4c3[nH]2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H30N2O/c1-28(2,3)17-15-22(26(32)23(16-17)29(4,5)6)27-30-24-20-13-9-7-11-18(20)19-12-8-10-14-21(19)25(24)31-27/h7-16,32H,1-6H3,(H,30,31) |
| InChIKey | RRTZTELFWMHWCG-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|