C28H24N2O3 — CID 10342985
2-[3-(4-tert-butylphenyl)phenyl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid (PubChem CID 10342985) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenyl)phenyl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid.
| Compound Name | 2-[3-(4-tert-butylphenyl)phenyl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid |
|---|---|
| PubChem CID | 10342985 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[3-(4-tert-butylphenyl)phenyl]-9-hydroxy-3H-benzo[e]benzimidazole-7-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3nc4c(ccc5cc(C(=O)O)cc(O)c54)[nH]3)c2)cc1 |
| InChI | InChI=1S/C28H24N2O3/c1-28(2,3)21-10-7-16(8-11-21)17-5-4-6-19(13-17)26-29-22-12-9-18-14-20(27(32)33)15-23(31)24(18)25(22)30-26/h4-15,31H,1-3H3,(H,29,30)(H,32,33) |
| InChIKey | PIEPXWFWRZNOOU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |