C22H30N6O2 — CID 136745062
6-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136745062) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136745062 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 6-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCOCCN1CCN(Cc2nc3c(cnn3-c3ccccc3)c(=O)[nH]2)CC1CC |
| InChI | InChI=1S/C22H30N6O2/c1-3-17-15-26(10-11-27(17)12-13-30-4-2)16-20-24-21-19(22(29)25-20)14-23-28(21)18-8-6-5-7-9-18/h5-9,14,17H,3-4,10-13,15-16H2,1-2H3,(H,24,25,29) |
| InChIKey | CQRZSSBSENBGRP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|