C18H28N6O — CID 95332993
(2S)-1-(2-ethoxyethyl)-2-ethyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine (PubChem CID 95332993) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S)-1-(2-ethoxyethyl)-2-ethyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine.
| Compound Name | (2S)-1-(2-ethoxyethyl)-2-ethyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 95332993 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | (2S)-1-(2-ethoxyethyl)-2-ethyl-4-[(1-phenyltetrazol-5-yl)methyl]piperazine |
| SMILES | CCOCCN1CCN(Cc2nnnn2-c2ccccc2)C[C@@H]1CC |
| InChI | InChI=1S/C18H28N6O/c1-3-16-14-22(10-11-23(16)12-13-25-4-2)15-18-19-20-21-24(18)17-8-6-5-7-9-17/h5-9,16H,3-4,10-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | VVWWGGWHNBLGOB-INIZCTEOSA-N |
| XLogP | 1.60 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|