C19H27FN4O2 — CID 86895063
2-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole (PubChem CID 86895063) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 86895063 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[[4-(2-ethoxyethyl)-3-ethylpiperazin-1-yl]methyl]-5-(4-fluorophenyl)-1,3,4-oxadiazole |
| SMILES | CCOCCN1CCN(Cc2nnc(-c3ccc(F)cc3)o2)CC1CC |
| InChI | InChI=1S/C19H27FN4O2/c1-3-17-13-23(9-10-24(17)11-12-25-4-2)14-18-21-22-19(26-18)15-5-7-16(20)8-6-15/h5-8,17H,3-4,9-14H2,1-2H3 |
| InChIKey | LYJBGRMCCJWCJB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|