C19H28N4O3 — CID 86895024
2-[[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole (PubChem CID 86895024) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 86895024 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-[[4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCOCCN1CCN(Cc2nnc(-c3ccc(OC)cc3)o2)CC1C |
| InChI | InChI=1S/C19H28N4O3/c1-4-25-12-11-23-10-9-22(13-15(23)2)14-18-20-21-19(26-18)16-5-7-17(24-3)8-6-16/h5-8,15H,4,9-14H2,1-3H3 |
| InChIKey | HJYDXGZDEGZWRD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|