C17H27N5OS — CID 95348101
4-[[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole (PubChem CID 95348101) has the molecular formula C17H27N5OS and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-[[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole.
| Compound Name | 4-[[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 95348101 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-[[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]methyl]-2-(1-methylpyrazol-4-yl)-1,3-thiazole |
| SMILES | CCOCCN1CCN(Cc2csc(-c3cnn(C)c3)n2)C[C@@H]1C |
| InChI | InChI=1S/C17H27N5OS/c1-4-23-8-7-22-6-5-21(10-14(22)2)12-16-13-24-17(19-16)15-9-18-20(3)11-15/h9,11,13-14H,4-8,10,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | QZUWQIMQBWCMHS-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|