C21H17N3O4S — CID 136748799
4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-3-hydroxy-2H-isoquinolin-1-one (PubChem CID 136748799) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-3-hydroxy-2H-isoquinolin-1-one.
| Compound Name | 4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-3-hydroxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 136748799 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]iminomethyl]-3-hydroxy-2H-isoquinolin-1-one |
| SMILES | COc1ccc(-c2csc(N=Cc3c(O)[nH]c(=O)c4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C21H17N3O4S/c1-27-17-8-7-12(9-18(17)28-2)16-11-29-21(23-16)22-10-15-13-5-3-4-6-14(13)19(25)24-20(15)26/h3-11H,1-2H3,(H2,24,25,26) |
| InChIKey | YKUACOTUGKSCMN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|