C23H20ClN3O3S — CID 136751971
(5S)-2-[(3-chlorophenyl)methylsulfanyl]-5-(2-prop-2-enoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 136751971) has the molecular formula C23H20ClN3O3S and a molecular weight of 453.95 g/mol. Its IUPAC name is (5S)-2-[(3-chlorophenyl)methylsulfanyl]-5-(2-prop-2-enoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-2-[(3-chlorophenyl)methylsulfanyl]-5-(2-prop-2-enoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 136751971 |
| Molecular Formula | C23H20ClN3O3S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | (5S)-2-[(3-chlorophenyl)methylsulfanyl]-5-(2-prop-2-enoxyphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | C=CCOc1ccccc1[C@@H]1CC(=O)Nc2nc(SCc3cccc(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C23H20ClN3O3S/c1-2-10-30-18-9-4-3-8-16(18)17-12-19(28)25-21-20(17)22(29)27-23(26-21)31-13-14-6-5-7-15(24)11-14/h2-9,11,17H,1,10,12-13H2,(H2,25,26,27,28,29)/t17-/m0/s1 |
| InChIKey | HFUFVHUEWYNMTB-KRWDZBQOSA-N |
| XLogP | 4.75 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|