C15H20Cl2N2S — CID 136756993
N-[1-(2,4-dichlorophenyl)ethyl]-4-ethyl-4-methyl-1,3-thiazinan-2-imine (PubChem CID 136756993) has the molecular formula C15H20Cl2N2S and a molecular weight of 331.31 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-4-ethyl-4-methyl-1,3-thiazinan-2-imine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-4-ethyl-4-methyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136756993 |
| Molecular Formula | C15H20Cl2N2S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-4-ethyl-4-methyl-1,3-thiazinan-2-imine |
| SMILES | CCC1(C)CCS/C(=N\C(C)c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C15H20Cl2N2S/c1-4-15(3)7-8-20-14(19-15)18-10(2)12-6-5-11(16)9-13(12)17/h5-6,9-10H,4,7-8H2,1-3H3,(H,18,19) |
| InChIKey | QBEFXZHZSXWRBX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|