C17H14FN3O3 — CID 136759246
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-oxo-3H-quinazoline-2-carboxamide (PubChem CID 136759246) has the molecular formula C17H14FN3O3 and a molecular weight of 327.31 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-oxo-3H-quinazoline-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-oxo-3H-quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 136759246 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-oxo-3H-quinazoline-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccccc1F)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H14FN3O3/c18-12-7-3-1-5-10(12)14(22)9-19-17(24)15-20-13-8-4-2-6-11(13)16(23)21-15/h1-8,14,22H,9H2,(H,19,24)(H,20,21,23) |
| InChIKey | SPDZEPXSLRIBLJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |