C17H18FNO3 — CID 136759251
4-ethoxy-2-[[2-(4-fluorophenyl)-2-hydroxyethyl]iminomethyl]phenol (PubChem CID 136759251) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-ethoxy-2-[[2-(4-fluorophenyl)-2-hydroxyethyl]iminomethyl]phenol.
| Compound Name | 4-ethoxy-2-[[2-(4-fluorophenyl)-2-hydroxyethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136759251 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-ethoxy-2-[[2-(4-fluorophenyl)-2-hydroxyethyl]iminomethyl]phenol |
| SMILES | CCOc1ccc(O)c(/C=N/CC(O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18FNO3/c1-2-22-15-7-8-16(20)13(9-15)10-19-11-17(21)12-3-5-14(18)6-4-12/h3-10,17,20-21H,2,11H2,1H3/b19-10+ |
| InChIKey | PDOAQYUJGXXUIO-VXLYETTFSA-N |
| XLogP | 3.08 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|