C13H20N2O4S — CID 136575617
N-[3-[(5-ethoxy-2-hydroxyphenyl)methylideneamino]propyl]methanesulfonamide (PubChem CID 136575617) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[3-[(5-ethoxy-2-hydroxyphenyl)methylideneamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(5-ethoxy-2-hydroxyphenyl)methylideneamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 136575617 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[3-[(5-ethoxy-2-hydroxyphenyl)methylideneamino]propyl]methanesulfonamide |
| SMILES | CCOc1ccc(O)c(/C=N/CCCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H20N2O4S/c1-3-19-12-5-6-13(16)11(9-12)10-14-7-4-8-15-20(2,17)18/h5-6,9-10,15-16H,3-4,7-8H2,1-2H3/b14-10+ |
| InChIKey | ITASISHVOSVIRS-GXDHUFHOSA-N |
| XLogP | 1.15 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|