C19H25F2N5OS — CID 136761045
1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methyl-3-thiophen-2-ylpropan-1-one (PubChem CID 136761045) has the molecular formula C19H25F2N5OS and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methyl-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methyl-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 136761045 |
| Molecular Formula | C19H25F2N5OS |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-2-methyl-3-thiophen-2-ylpropan-1-one |
| SMILES | CC(Cc1cccs1)C(=O)N1CCCC([C@@H]2C[C@H](C(F)F)n3ncnc3N2)C1 |
| InChI | InChI=1S/C19H25F2N5OS/c1-12(8-14-5-3-7-28-14)18(27)25-6-2-4-13(10-25)15-9-16(17(20)21)26-19(24-15)22-11-23-26/h3,5,7,11-13,15-17H,2,4,6,8-10H2,1H3,(H,22,23,24)/t12?,13?,15-,16+/m0/s1 |
| InChIKey | AHKAVJQJVIVQTF-FPCDFSMTSA-N |
| XLogP | 3.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |