C16H23F2N5O2 — CID 136761023
[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(oxolan-3-yl)methanone (PubChem CID 136761023) has the molecular formula C16H23F2N5O2 and a molecular weight of 355.39 g/mol. Its IUPAC name is [3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(oxolan-3-yl)methanone.
| Compound Name | [3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 136761023 |
| Molecular Formula | C16H23F2N5O2 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]-(oxolan-3-yl)methanone |
| SMILES | O=C(C1CCOC1)N1CCCC([C@@H]2C[C@H](C(F)F)n3ncnc3N2)C1 |
| InChI | InChI=1S/C16H23F2N5O2/c17-14(18)13-6-12(21-16-19-9-20-23(13)16)10-2-1-4-22(7-10)15(24)11-3-5-25-8-11/h9-14H,1-8H2,(H,19,20,21)/t10?,11?,12-,13+/m0/s1 |
| InChIKey | XJACGCFESIDEPK-IFWUJCSASA-N |
| XLogP | 1.54 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |