C18H27F2N5O — CID 136761004
cyclohexyl-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136761004) has the molecular formula C18H27F2N5O and a molecular weight of 367.44 g/mol. Its IUPAC name is cyclohexyl-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136761004 |
| Molecular Formula | C18H27F2N5O |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | cyclohexyl-[3-[(5S,7R)-7-(difluoromethyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCCC([C@@H]2C[C@H](C(F)F)n3ncnc3N2)C1 |
| InChI | InChI=1S/C18H27F2N5O/c19-16(20)15-9-14(23-18-21-11-22-25(15)18)13-7-4-8-24(10-13)17(26)12-5-2-1-3-6-12/h11-16H,1-10H2,(H,21,22,23)/t13?,14-,15+/m0/s1 |
| InChIKey | PSTURCJIMLZGRE-NOYMGPGASA-N |
| XLogP | 3.09 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |