C19H28F2N4O — CID 136860578
cyclopentyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone (PubChem CID 136860578) has the molecular formula C19H28F2N4O and a molecular weight of 366.46 g/mol. Its IUPAC name is cyclopentyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopentyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136860578 |
| Molecular Formula | C19H28F2N4O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | cyclopentyl-[(3R)-3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H]([C@@H]1CCCN(C(=O)C3CCCC3)C1)N2 |
| InChI | InChI=1S/C19H28F2N4O/c1-12-9-17-22-15(10-16(18(20)21)25(17)23-12)14-7-4-8-24(11-14)19(26)13-5-2-3-6-13/h9,13-16,18,22H,2-8,10-11H2,1H3/t14-,15+,16-/m1/s1 |
| InChIKey | OTFRQDFJPSPSBA-OWCLPIDISA-N |
| XLogP | 3.61 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |