C22H33F2N5O2 — CID 136760863
1-tert-butyl-4-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 136760863) has the molecular formula C22H33F2N5O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-tert-butyl-4-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-tert-butyl-4-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 136760863 |
| Molecular Formula | C22H33F2N5O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 1-tert-butyl-4-[3-[(5S,7R)-7-(difluoromethyl)-2-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1cc2n(n1)[C@@H](C(F)F)C[C@@H](C1CCCN(C(=O)C3CC(=O)N(C(C)(C)C)C3)C1)N2 |
| InChI | InChI=1S/C22H33F2N5O2/c1-13-8-18-25-16(10-17(20(23)24)29(18)26-13)14-6-5-7-27(11-14)21(31)15-9-19(30)28(12-15)22(2,3)4/h8,14-17,20,25H,5-7,9-12H2,1-4H3/t14?,15?,16-,17+/m0/s1 |
| InChIKey | OZRPUBLZGFVGPK-SJJHQCBESA-N |
| XLogP | 3.07 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |